Salicylanilide
Salicylanilide
 |
| Names |
Preferred IUPAC name
2-Hydroxy-N-phenylbenzamide |
| Other names
|
| Identifiers |
|
|
|
|
|
1108135 |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.001.571  |
| EC Number |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16) NKey: WKEDVNSFRWHDNR-UHFFFAOYSA-N NInChI=1/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16) Key: WKEDVNSFRWHDNR-UHFFFAOYAI
|
C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2O
|
| Properties |
|
C13H11NO2 |
| Molar mass |
213.236 g·mol−1 |
| Appearance |
White to off-white crystalline solid |
| Melting point |
136 to 138 °C (277 to 280 °F; 409 to 411 K) |
| Hazards |
| GHS labelling:[1] |
|
  |
|
Warning |
|
H315, H319, H335, H400 |
|
P261, P264, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P391, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Salicylanilide is a chemical compound which is the amide of salicylic acid and aniline. It is classified as both a salicylamide and an anilide.[2]
Derivatives of salicylanilide have a variety of pharmacological uses. Chlorinated derivatives including niclosamide, oxyclozanide, and rafoxanide are used as anthelmintics, especially against parasitic flatworms. Brominated derivatives including dibromsalan, metabromsalan, and tribromsalan are used as topical antibacterials and antifungals.
Niclosamide
Oxyclozanide
Rafoxanide