Disperse Red 11Chemical compound
Disperse Red 11
 |
| Names |
Preferred IUPAC name
1,4-Diamino-2-methoxyanthracene-9,10-dione |
| Other names
|
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.018.822  |
| EC Number |
|
|
|
| UNII |
|
|
|
InChI=1S/C15H12N2O3/c1-20-10-6-9(16)11-12(13(10)17)15(19)8-5-3-2-4-7(8)14(11)18/h2-6H,16-17H2,1H3 Key: TUXJTJITXCHUEL-UHFFFAOYSA-N InChI=1S/C15H12N2O3/c1-20-10-6-9(16)11-12(13(10)17)15(19)8-5-3-2-4-7(8)14(11)18/h2-6H,16-17H2,1H3
|
Nc1c(OC)cc(N)c(C(c2ccccc23)=O)c1C3=O
|
| Properties |
|
C15H12N2O3 |
| Molar mass |
268.272 g·mol−1 |
| Hazards |
| GHS labelling: |
|
 |
|
Warning |
|
H302, H315, H317, H319, H335 |
|
P261, P264, P270, P271, P272, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P333+P313, P337+P313, P362, P363, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Disperse Red 11, or 1,4-diamino-2-methoxyanthraquinone, is a red disperse dye derived from anthraquinone.[1][2][3] It is water insoluble.[1]
Disperse Red 11 can be used in plastics and textiles industry to dye polyvinylchloride, polyester, polyamide, and polyurethane materials, such as synthetic fibers and foams. It is also used in cosmetics and in some red and violet-red colored smoke formulations.