3,4-Methylenedioxyphenylpropan-2-one
MDP2P
 |
| Names |
Preferred IUPAC name
1-(2H-1,3-Benzodioxol-5-yl)propan-2-one |
| Other names
3,4-methylenedioxyphenyl-2-propanone 1-(1,3-benzodioxol-5-yl)propan-2-one piperonyl methyl ketone 3,4-methylenedioxyphenylacetone |
| Identifiers |
|
|
|
|
| Abbreviations |
MDP2P, PMK |
| ChemSpider |
|
| ECHA InfoCard |
100.022.843  |
|
|
| UNII |
|
|
|
InChI=1S/C10H10O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5H,4,6H2,1H3 YKey: XIYKRJLTYKUWAM-UHFFFAOYSA-N YInChI=1/C10H10O3/c1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h2-3,5H,4,6H2,1H3 Key: XIYKRJLTYKUWAM-UHFFFAOYAA
|
|
| Properties |
|
C10H10O3 |
| Molar mass |
178.185 g/mol |
| Appearance |
Yellowish green liquid (when impure) |
| Density |
1.211 g/cm3 |
| Boiling point |
290 °C (554 °F; 563 K) |
| Pharmacology |
| Legal status |
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
3,4-Methylenedioxyphenylpropan-2-one[1] or piperonyl methyl ketone (MDP2P or PMK) is a chemical compound consisting of a phenylacetone moiety substituted with a methylenedioxy functional group. It is commonly synthesized from either safrole or its isomer isosafrole via oxidation using the Wacker oxidation or peroxyacid oxidation methods.
MDP2P is a precursor in the chemical synthesis of the methylenedioxyphenethylamine (MDxx) class of compounds, the classic example of which is 3,4-methylenedioxy-N-methylamphetamine (MDMA), and is also an intermediate between the MDxx family and their slightly more distant precursor safrole or isosafrole. On account of its relation to the MDxx chemical class, MDP2P, as well as safrole and isosafrole, are in the United States (U.S.) Drug Enforcement Administration (DEA) List I of Chemicals of the Controlled Substances Act (CSA) via the Chemical Diversion and Trafficking Act (CDTA). It is also considered a category 1 precursor in the European Union.